C19H21ClFN3O4S2 — CID 14555818
oxolan-2-ylmethyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate (PubChem CID 14555818) has the molecular formula C19H21ClFN3O4S2 and a molecular weight of 473.98 g/mol. Its IUPAC name is oxolan-2-ylmethyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate.
| Compound Name | oxolan-2-ylmethyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 14555818 |
| Molecular Formula | C19H21ClFN3O4S2 |
| Molecular Weight | 473.98 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | oxolan-2-ylmethyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate |
| SMILES | O=C(CSc1cc(/N=c2\sc(=O)n3n2CCCC3)c(F)cc1Cl)OCC1CCCO1 |
| InChI | InChI=1S/C19H21ClFN3O4S2/c20-13-8-14(21)15(22-18-23-5-1-2-6-24(23)19(26)30-18)9-16(13)29-11-17(25)28-10-12-4-3-7-27-12/h8-9,12H,1-7,10-11H2/b22-18- |
| InChIKey | UJJUZKUIQLNKTH-PYCFMQQDSA-N |
| XLogP | 3.34 |
| TPSA | 74.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.98 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |