About 2-(acridin-9-ylmethylamino)-2-methylpropane-1,3-diol;dihydrochloride
2-(acridin-9-ylmethylamino)-2-methylpropane-1,3-diol;dihydrochloride (PubChem CID 14555904) has the molecular formula C18H22Cl2N2O2
and a molecular weight of 369.29 g/mol. Its IUPAC name is 2-(acridin-9-ylmethylamino)-2-methylpropane-1,3-diol;dihydrochloride.
Molecular Properties
| Compound Name | 2-(acridin-9-ylmethylamino)-2-methylpropane-1,3-diol;dihydrochloride |
| PubChem CID | 14555904 |
| Molecular Formula | C18H22Cl2N2O2 |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 2-(acridin-9-ylmethylamino)-2-methylpropane-1,3-diol;dihydrochloride |
| SMILES | CC(CO)(CO)NCc1c2ccccc2nc2ccccc12.Cl.Cl |
| InChI | InChI=1S/C18H20N2O2.2ClH/c1-18(11-21,12-22)19-10-15-13-6-2-4-8-16(13)20-17-9-5-3-7-14(15)17;;/h2-9,19,21-22H,10-12H2,1H3;2*1H |
| InChIKey | WKDPNMRSVFUMDI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(acridin-9-ylmethylamino)-2-methylpropane-1,3-diol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(acridin-9-ylmethylamino)-2-methylpropane-1,3-diol;dihydrochloride?
The IUPAC name of 2-(acridin-9-ylmethylamino)-2-methylpropane-1,3-diol;dihydrochloride (CID 14555904) is 2-(acridin-9-ylmethylamino)-2-methylpropane-1,3-diol;dihydrochloride.
What is the SMILES notation for 2-(acridin-9-ylmethylamino)-2-methylpropane-1,3-diol;dihydrochloride?
The canonical SMILES for 2-(acridin-9-ylmethylamino)-2-methylpropane-1,3-diol;dihydrochloride is CC(CO)(CO)NCc1c2ccccc2nc2ccccc12.Cl.Cl.
What is the InChIKey of 2-(acridin-9-ylmethylamino)-2-methylpropane-1,3-diol;dihydrochloride?
The InChIKey is WKDPNMRSVFUMDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O2.2ClH/c1-18(11-21,12-22)19-10-15-13-6-2-4-8-16(13)20-17-9-5-3-7-14(15)17;;/h2-9,19,21-22H,10-12H2,1H3;2*1H.
What are the key properties of 2-(acridin-9-ylmethylamino)-2-methylpropane-1,3-diol;dihydrochloride?
2-(acridin-9-ylmethylamino)-2-methylpropane-1,3-diol;dihydrochloride has a molecular weight of 369.29 g/mol, XLogP of 3.06, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(acridin-9-ylmethylamino)-2-methylpropane-1,3-diol;dihydrochloride is sourced from PubChem (CID 14555904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).