C11H11ClN2S — CID 14556375
2-chloro-5-(2,4,6-trimethylphenyl)-1,3,4-thiadiazole (PubChem CID 14556375) has the molecular formula C11H11ClN2S and a molecular weight of 238.74 g/mol. Its IUPAC name is 2-chloro-5-(2,4,6-trimethylphenyl)-1,3,4-thiadiazole.
| Compound Name | 2-chloro-5-(2,4,6-trimethylphenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 14556375 |
| Molecular Formula | C11H11ClN2S |
| Molecular Weight | 238.74 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 2-chloro-5-(2,4,6-trimethylphenyl)-1,3,4-thiadiazole |
| SMILES | Cc1cc(C)c(-c2nnc(Cl)s2)c(C)c1 |
| InChI | InChI=1S/C11H11ClN2S/c1-6-4-7(2)9(8(3)5-6)10-13-14-11(12)15-10/h4-5H,1-3H3 |
| InChIKey | VLXOQWIRORZHNV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.74 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |