C13H16Cl2N4S — CID 14556415
N-[5-(2,4-dichlorophenyl)-1,3,4-thiadiazol-2-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 14556415) has the molecular formula C13H16Cl2N4S and a molecular weight of 331.27 g/mol. Its IUPAC name is N-[5-(2,4-dichlorophenyl)-1,3,4-thiadiazol-2-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[5-(2,4-dichlorophenyl)-1,3,4-thiadiazol-2-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 14556415 |
| Molecular Formula | C13H16Cl2N4S |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | N-[5-(2,4-dichlorophenyl)-1,3,4-thiadiazol-2-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1nnc(-c2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C13H16Cl2N4S/c1-19(2)7-3-6-16-13-18-17-12(20-13)10-5-4-9(14)8-11(10)15/h4-5,8H,3,6-7H2,1-2H3,(H,16,18) |
| InChIKey | HRJIICISMTYZGZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|