About [2-(1-aminocyclopropyl)-1,3-dioxolan-2-yl]methanol
[2-(1-aminocyclopropyl)-1,3-dioxolan-2-yl]methanol (PubChem CID 14557944) has the molecular formula C7H13NO3
and a molecular weight of 159.18 g/mol. Its IUPAC name is [2-(1-aminocyclopropyl)-1,3-dioxolan-2-yl]methanol.
Molecular Properties
| Compound Name | [2-(1-aminocyclopropyl)-1,3-dioxolan-2-yl]methanol |
| PubChem CID | 14557944 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | [2-(1-aminocyclopropyl)-1,3-dioxolan-2-yl]methanol |
| SMILES | NC1(C2(CO)OCCO2)CC1 |
| InChI | InChI=1S/C7H13NO3/c8-6(1-2-6)7(5-9)10-3-4-11-7/h9H,1-5,8H2 |
| InChIKey | BDXOZYXFYOKZOC-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(1-aminocyclopropyl)-1,3-dioxolan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1-aminocyclopropyl)-1,3-dioxolan-2-yl]methanol?
The IUPAC name of [2-(1-aminocyclopropyl)-1,3-dioxolan-2-yl]methanol (CID 14557944) is [2-(1-aminocyclopropyl)-1,3-dioxolan-2-yl]methanol.
What is the SMILES notation for [2-(1-aminocyclopropyl)-1,3-dioxolan-2-yl]methanol?
The canonical SMILES for [2-(1-aminocyclopropyl)-1,3-dioxolan-2-yl]methanol is NC1(C2(CO)OCCO2)CC1.
What is the InChIKey of [2-(1-aminocyclopropyl)-1,3-dioxolan-2-yl]methanol?
The InChIKey is BDXOZYXFYOKZOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3/c8-6(1-2-6)7(5-9)10-3-4-11-7/h9H,1-5,8H2.
What are the key properties of [2-(1-aminocyclopropyl)-1,3-dioxolan-2-yl]methanol?
[2-(1-aminocyclopropyl)-1,3-dioxolan-2-yl]methanol has a molecular weight of 159.18 g/mol, XLogP of -0.79, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1-aminocyclopropyl)-1,3-dioxolan-2-yl]methanol is sourced from PubChem (CID 14557944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).