About barium(2+);bis((2S)-5-oxopyrrolidine-2-carboxylate)
barium(2+);bis((2S)-5-oxopyrrolidine-2-carboxylate) (PubChem CID 14559050) has the molecular formula C10H12BaN2O6
and a molecular weight of 393.54 g/mol. Its IUPAC name is barium(2+);bis((2S)-5-oxopyrrolidine-2-carboxylate).
Molecular Properties
| Compound Name | barium(2+);bis((2S)-5-oxopyrrolidine-2-carboxylate) |
| PubChem CID | 14559050 |
| Molecular Formula | C10H12BaN2O6 |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | barium(2+);bis((2S)-5-oxopyrrolidine-2-carboxylate) |
| SMILES | O=C1CC[C@@H](C(=O)[O-])N1.O=C1CC[C@@H](C(=O)[O-])N1.[Ba+2] |
| InChI | InChI=1S/2C5H7NO3.Ba/c2*7-4-2-1-3(6-4)5(8)9;/h2*3H,1-2H2,(H,6,7)(H,8,9);/q;;+2/p-2/t2*3-;/m00./s1 |
| InChIKey | WHSQXGSLLYMUIG-QHTZZOMLSA-L |
| XLogP | -4.35 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | -4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze barium(2+);bis((2S)-5-oxopyrrolidine-2-carboxylate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis((2S)-5-oxopyrrolidine-2-carboxylate)?
The IUPAC name of barium(2+);bis((2S)-5-oxopyrrolidine-2-carboxylate) (CID 14559050) is barium(2+);bis((2S)-5-oxopyrrolidine-2-carboxylate).
What is the SMILES notation for barium(2+);bis((2S)-5-oxopyrrolidine-2-carboxylate)?
The canonical SMILES for barium(2+);bis((2S)-5-oxopyrrolidine-2-carboxylate) is O=C1CC[C@@H](C(=O)[O-])N1.O=C1CC[C@@H](C(=O)[O-])N1.[Ba+2].
What is the InChIKey of barium(2+);bis((2S)-5-oxopyrrolidine-2-carboxylate)?
The InChIKey is WHSQXGSLLYMUIG-QHTZZOMLSA-L. The full InChI is InChI=1S/2C5H7NO3.Ba/c2*7-4-2-1-3(6-4)5(8)9;/h2*3H,1-2H2,(H,6,7)(H,8,9);/q;;+2/p-2/t2*3-;/m00./s1.
What are the key properties of barium(2+);bis((2S)-5-oxopyrrolidine-2-carboxylate)?
barium(2+);bis((2S)-5-oxopyrrolidine-2-carboxylate) has a molecular weight of 393.54 g/mol, XLogP of -4.35, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis((2S)-5-oxopyrrolidine-2-carboxylate) is sourced from PubChem (CID 14559050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).