C18H17Br2NO7 — CID 14559865
4-[3,5-dibromo-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]iminocyclohexa-2,5-dien-1-one (PubChem CID 14559865) has the molecular formula C18H17Br2NO7 and a molecular weight of 519.14 g/mol. Its IUPAC name is 4-[3,5-dibromo-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]iminocyclohexa-2,5-dien-1-one.
| Compound Name | 4-[3,5-dibromo-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]iminocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 14559865 |
| Molecular Formula | C18H17Br2NO7 |
| Molecular Weight | 519.14 g/mol |
| Exact Mass | 516.94 |
| IUPAC Name | 4-[3,5-dibromo-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]iminocyclohexa-2,5-dien-1-one |
| SMILES | O=C1C=CC(=Nc2cc(Br)c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(Br)c2)C=C1 |
| InChI | InChI=1S/C18H17Br2NO7/c19-11-5-9(21-8-1-3-10(23)4-2-8)6-12(20)17(11)28-18-16(26)15(25)14(24)13(7-22)27-18/h1-6,13-16,18,22,24-26H,7H2/t13-,14-,15+,16-,18+/m1/s1 |
| InChIKey | ZVFYTPFCNFTRBP-QFXBJFAPSA-N |
| XLogP | 1.16 |
| TPSA | 128.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.14 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|