C29H31F2NO5 — CID 14560981
N-[(2S,3R,4R,6R)-5,5-difluoro-2,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide (PubChem CID 14560981) has the molecular formula C29H31F2NO5 and a molecular weight of 511.57 g/mol. Its IUPAC name is N-[(2S,3R,4R,6R)-5,5-difluoro-2,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2S,3R,4R,6R)-5,5-difluoro-2,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 14560981 |
| Molecular Formula | C29H31F2NO5 |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | N-[(2S,3R,4R,6R)-5,5-difluoro-2,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@@H](OCc2ccccc2)O[C@H](COCc2ccccc2)C(F)(F)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H31F2NO5/c1-21(33)32-26-27(35-18-23-13-7-3-8-14-23)29(30,31)25(20-34-17-22-11-5-2-6-12-22)37-28(26)36-19-24-15-9-4-10-16-24/h2-16,25-28H,17-20H2,1H3,(H,32,33)/t25-,26-,27-,28+/m1/s1 |
| InChIKey | GHDRXQZNKJBIRF-HPQIJTKRSA-N |
| XLogP | 4.87 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |