C37H76O6Si4 — CID 14561927
5-[(Z,1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]hex-3-enyl]-2,2-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylfuran-3-one (PubChem CID 14561927) has the molecular formula C37H76O6Si4 and a molecular weight of 729.35 g/mol. Its IUPAC name is 5-[(Z,1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]hex-3-enyl]-2,2-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylfuran-3-one.
| Compound Name | 5-[(Z,1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]hex-3-enyl]-2,2-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylfuran-3-one |
|---|---|
| PubChem CID | 14561927 |
| Molecular Formula | C37H76O6Si4 |
| Molecular Weight | 729.35 g/mol |
| Exact Mass | 728.47 |
| IUPAC Name | 5-[(Z,1S,2S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]hex-3-enyl]-2,2-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylfuran-3-one |
| SMILES | CC/C=C\[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C1=C(C)C(=O)C(CO[Si](C)(C)C(C)(C)C)(CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C37H76O6Si4/c1-23-24-25-29(42-46(19,20)35(9,10)11)31(43-47(21,22)36(12,13)14)30-28(2)32(38)37(41-30,26-39-44(15,16)33(3,4)5)27-40-45(17,18)34(6,7)8/h24-25,29,31H,23,26-27H2,1-22H3/b25-24-/t29-,31-/m0/s1 |
| InChIKey | QPEGNOLAQRFWOK-HXAPPUSTSA-N |
| XLogP | 11.39 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.35 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|