C15H22O6 — CID 14561931
5-[(4S,5S)-5-[(Z)-but-1-enyl]-2-methyl-1,3-dioxolan-4-yl]-2,2-bis(hydroxymethyl)-4-methylfuran-3-one (PubChem CID 14561931) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is 5-[(4S,5S)-5-[(Z)-but-1-enyl]-2-methyl-1,3-dioxolan-4-yl]-2,2-bis(hydroxymethyl)-4-methylfuran-3-one.
| Compound Name | 5-[(4S,5S)-5-[(Z)-but-1-enyl]-2-methyl-1,3-dioxolan-4-yl]-2,2-bis(hydroxymethyl)-4-methylfuran-3-one |
|---|---|
| PubChem CID | 14561931 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 5-[(4S,5S)-5-[(Z)-but-1-enyl]-2-methyl-1,3-dioxolan-4-yl]-2,2-bis(hydroxymethyl)-4-methylfuran-3-one |
| SMILES | CC/C=C\[C@@H]1OC(C)O[C@@H]1C1=C(C)C(=O)C(CO)(CO)O1 |
| InChI | InChI=1S/C15H22O6/c1-4-5-6-11-13(20-10(3)19-11)12-9(2)14(18)15(7-16,8-17)21-12/h5-6,10-11,13,16-17H,4,7-8H2,1-3H3/b6-5-/t10?,11-,13-/m0/s1 |
| InChIKey | JXLGQZKRYNETNG-CLTNUMGLSA-N |
| XLogP | 0.68 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|