C20H38OSi2 — CID 14562860
(2E,7Z)-9-trimethylsilyl-2-[(Z)-5-trimethylsilylpent-3-enyl]nona-2,7-dienal (PubChem CID 14562860) has the molecular formula C20H38OSi2 and a molecular weight of 350.70 g/mol. Its IUPAC name is (2E,7Z)-9-trimethylsilyl-2-[(Z)-5-trimethylsilylpent-3-enyl]nona-2,7-dienal.
| Compound Name | (2E,7Z)-9-trimethylsilyl-2-[(Z)-5-trimethylsilylpent-3-enyl]nona-2,7-dienal |
|---|---|
| PubChem CID | 14562860 |
| Molecular Formula | C20H38OSi2 |
| Molecular Weight | 350.70 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (2E,7Z)-9-trimethylsilyl-2-[(Z)-5-trimethylsilylpent-3-enyl]nona-2,7-dienal |
| SMILES | C[Si](C)(C)C/C=C\CCC/C=C(/C=O)CC/C=C\C[Si](C)(C)C |
| InChI | InChI=1S/C20H38OSi2/c1-22(2,3)17-13-9-7-8-11-15-20(19-21)16-12-10-14-18-23(4,5)6/h9-10,13-15,19H,7-8,11-12,16-18H2,1-6H3/b13-9-,14-10-,20-15+ |
| InChIKey | OIEQLHMXAMUGPO-RKAFZFQMSA-N |
| XLogP | 6.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.70 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|