About (7S,8S)-7-ethenyl-8-propan-2-yl-1,4-dioxaspiro[4.5]decane
(7S,8S)-7-ethenyl-8-propan-2-yl-1,4-dioxaspiro[4.5]decane (PubChem CID 14564109) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is (7S,8S)-7-ethenyl-8-propan-2-yl-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | (7S,8S)-7-ethenyl-8-propan-2-yl-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 14564109 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (7S,8S)-7-ethenyl-8-propan-2-yl-1,4-dioxaspiro[4.5]decane |
| SMILES | C=C[C@@H]1CC2(CC[C@H]1C(C)C)OCCO2 |
| InChI | InChI=1S/C13H22O2/c1-4-11-9-13(14-7-8-15-13)6-5-12(11)10(2)3/h4,10-12H,1,5-9H2,2-3H3/t11-,12+/m1/s1 |
| InChIKey | JDJPLLRCBUZNTK-NEPJUHHUSA-N |
| XLogP | 2.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7S,8S)-7-ethenyl-8-propan-2-yl-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S,8S)-7-ethenyl-8-propan-2-yl-1,4-dioxaspiro[4.5]decane?
The IUPAC name of (7S,8S)-7-ethenyl-8-propan-2-yl-1,4-dioxaspiro[4.5]decane (CID 14564109) is (7S,8S)-7-ethenyl-8-propan-2-yl-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for (7S,8S)-7-ethenyl-8-propan-2-yl-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for (7S,8S)-7-ethenyl-8-propan-2-yl-1,4-dioxaspiro[4.5]decane is C=C[C@@H]1CC2(CC[C@H]1C(C)C)OCCO2.
What is the InChIKey of (7S,8S)-7-ethenyl-8-propan-2-yl-1,4-dioxaspiro[4.5]decane?
The InChIKey is JDJPLLRCBUZNTK-NEPJUHHUSA-N. The full InChI is InChI=1S/C13H22O2/c1-4-11-9-13(14-7-8-15-13)6-5-12(11)10(2)3/h4,10-12H,1,5-9H2,2-3H3/t11-,12+/m1/s1.
What are the key properties of (7S,8S)-7-ethenyl-8-propan-2-yl-1,4-dioxaspiro[4.5]decane?
(7S,8S)-7-ethenyl-8-propan-2-yl-1,4-dioxaspiro[4.5]decane has a molecular weight of 210.32 g/mol, XLogP of 2.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7S,8S)-7-ethenyl-8-propan-2-yl-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 14564109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).