About 4-(4-aminophenyl)phenol
4-(4-aminophenyl)phenol (PubChem CID 14565) has the molecular formula C12H11NO
and a molecular weight of 185.23 g/mol. Its IUPAC name is 4-(4-aminophenyl)phenol.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)phenol |
| PubChem CID | 14565 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 4-(4-aminophenyl)phenol |
| SMILES | Nc1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C12H11NO/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8,14H,13H2 |
| InChIKey | LQZZZAFQKXTFKH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)phenol?
The IUPAC name of 4-(4-aminophenyl)phenol (CID 14565) is 4-(4-aminophenyl)phenol.
What is the SMILES notation for 4-(4-aminophenyl)phenol?
The canonical SMILES for 4-(4-aminophenyl)phenol is Nc1ccc(-c2ccc(O)cc2)cc1.
What is the InChIKey of 4-(4-aminophenyl)phenol?
The InChIKey is LQZZZAFQKXTFKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8,14H,13H2.
What are the key properties of 4-(4-aminophenyl)phenol?
4-(4-aminophenyl)phenol has a molecular weight of 185.23 g/mol, XLogP of 2.64, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)phenol is sourced from PubChem (CID 14565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).