About [(Z)-7,7-diethoxyhept-3-en-1,5-diynyl]-trimethylsilane
[(Z)-7,7-diethoxyhept-3-en-1,5-diynyl]-trimethylsilane (PubChem CID 14565407) has the molecular formula C14H22O2Si
and a molecular weight of 250.41 g/mol. Its IUPAC name is [(Z)-7,7-diethoxyhept-3-en-1,5-diynyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(Z)-7,7-diethoxyhept-3-en-1,5-diynyl]-trimethylsilane |
| PubChem CID | 14565407 |
| Molecular Formula | C14H22O2Si |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | [(Z)-7,7-diethoxyhept-3-en-1,5-diynyl]-trimethylsilane |
| SMILES | CCOC(C#C/C=C\C#C[Si](C)(C)C)OCC |
| InChI | InChI=1S/C14H22O2Si/c1-6-15-14(16-7-2)12-10-8-9-11-13-17(3,4)5/h8-9,14H,6-7H2,1-5H3/b9-8- |
| InChIKey | BPOQXQBNXSSHBD-HJWRWDBZSA-N |
| XLogP | 2.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-7,7-diethoxyhept-3-en-1,5-diynyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-7,7-diethoxyhept-3-en-1,5-diynyl]-trimethylsilane?
The IUPAC name of [(Z)-7,7-diethoxyhept-3-en-1,5-diynyl]-trimethylsilane (CID 14565407) is [(Z)-7,7-diethoxyhept-3-en-1,5-diynyl]-trimethylsilane.
What is the SMILES notation for [(Z)-7,7-diethoxyhept-3-en-1,5-diynyl]-trimethylsilane?
The canonical SMILES for [(Z)-7,7-diethoxyhept-3-en-1,5-diynyl]-trimethylsilane is CCOC(C#C/C=C\C#C[Si](C)(C)C)OCC.
What is the InChIKey of [(Z)-7,7-diethoxyhept-3-en-1,5-diynyl]-trimethylsilane?
The InChIKey is BPOQXQBNXSSHBD-HJWRWDBZSA-N. The full InChI is InChI=1S/C14H22O2Si/c1-6-15-14(16-7-2)12-10-8-9-11-13-17(3,4)5/h8-9,14H,6-7H2,1-5H3/b9-8-.
What are the key properties of [(Z)-7,7-diethoxyhept-3-en-1,5-diynyl]-trimethylsilane?
[(Z)-7,7-diethoxyhept-3-en-1,5-diynyl]-trimethylsilane has a molecular weight of 250.41 g/mol, XLogP of 2.83, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-7,7-diethoxyhept-3-en-1,5-diynyl]-trimethylsilane is sourced from PubChem (CID 14565407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).