C20H26O2 — CID 14565466
(1S,8Z,13R,17R)-4,9,13,17-tetramethyl-6-oxatricyclo[11.4.0.03,7]heptadeca-3(7),4,8,15-tetraen-14-one (PubChem CID 14565466) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (1S,8Z,13R,17R)-4,9,13,17-tetramethyl-6-oxatricyclo[11.4.0.03,7]heptadeca-3(7),4,8,15-tetraen-14-one.
| Compound Name | (1S,8Z,13R,17R)-4,9,13,17-tetramethyl-6-oxatricyclo[11.4.0.03,7]heptadeca-3(7),4,8,15-tetraen-14-one |
|---|---|
| PubChem CID | 14565466 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (1S,8Z,13R,17R)-4,9,13,17-tetramethyl-6-oxatricyclo[11.4.0.03,7]heptadeca-3(7),4,8,15-tetraen-14-one |
| SMILES | C/C1=C/c2occ(C)c2C[C@H]2[C@H](C)C=CC(=O)[C@]2(C)CCC1 |
| InChI | InChI=1S/C20H26O2/c1-13-6-5-9-20(4)17(14(2)7-8-19(20)21)11-16-15(3)12-22-18(16)10-13/h7-8,10,12,14,17H,5-6,9,11H2,1-4H3/b13-10-/t14-,17+,20-/m1/s1 |
| InChIKey | LHJBKKIYSPMWTO-RXXGLDPESA-N |
| XLogP | 5.12 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |