C16H24O6 — CID 14565755
methyl 2-[(3R,5aS,6R,9S,9aR)-9a-formyl-3-hydroxy-3,6-dimethyl-5,5a,6,7,8,9-hexahydro-4H-benzo[c]dioxepin-9-yl]prop-2-enoate (PubChem CID 14565755) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is methyl 2-[(3R,5aS,6R,9S,9aR)-9a-formyl-3-hydroxy-3,6-dimethyl-5,5a,6,7,8,9-hexahydro-4H-benzo[c]dioxepin-9-yl]prop-2-enoate.
| Compound Name | methyl 2-[(3R,5aS,6R,9S,9aR)-9a-formyl-3-hydroxy-3,6-dimethyl-5,5a,6,7,8,9-hexahydro-4H-benzo[c]dioxepin-9-yl]prop-2-enoate |
|---|---|
| PubChem CID | 14565755 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | methyl 2-[(3R,5aS,6R,9S,9aR)-9a-formyl-3-hydroxy-3,6-dimethyl-5,5a,6,7,8,9-hexahydro-4H-benzo[c]dioxepin-9-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC[C@@H](C)[C@@H]2CC[C@](C)(O)OO[C@@]12C=O |
| InChI | InChI=1S/C16H24O6/c1-10-5-6-13(11(2)14(18)20-4)16(9-17)12(10)7-8-15(3,19)21-22-16/h9-10,12-13,19H,2,5-8H2,1,3-4H3/t10-,12+,13+,15-,16-/m1/s1 |
| InChIKey | LPQGQQHWSJMALE-ZPPJNMKPSA-N |
| XLogP | 1.77 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|