C15H24O3S — CID 14565891
(2E,6E)-2,6-dimethyl-8-(3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)octa-2,6-dien-1-ol (PubChem CID 14565891) has the molecular formula C15H24O3S and a molecular weight of 284.42 g/mol. Its IUPAC name is (2E,6E)-2,6-dimethyl-8-(3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)octa-2,6-dien-1-ol.
| Compound Name | (2E,6E)-2,6-dimethyl-8-(3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)octa-2,6-dien-1-ol |
|---|---|
| PubChem CID | 14565891 |
| Molecular Formula | C15H24O3S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (2E,6E)-2,6-dimethyl-8-(3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)octa-2,6-dien-1-ol |
| SMILES | CC1=CCS(=O)(=O)C1C/C=C(\C)CC/C=C(\C)CO |
| InChI | InChI=1S/C15H24O3S/c1-12(5-4-6-13(2)11-16)7-8-15-14(3)9-10-19(15,17)18/h6-7,9,15-16H,4-5,8,10-11H2,1-3H3/b12-7+,13-6+ |
| InChIKey | FEHXEKRHNQQBHX-GTAKWKLUSA-N |
| XLogP | 2.78 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|