C6H11N3S2 — CID 14566159
4-butyl-1,2,4-triazolidine-3,5-dithione (PubChem CID 14566159) has the molecular formula C6H11N3S2 and a molecular weight of 189.31 g/mol. Its IUPAC name is 4-butyl-1,2,4-triazolidine-3,5-dithione.
| Compound Name | 4-butyl-1,2,4-triazolidine-3,5-dithione |
|---|---|
| PubChem CID | 14566159 |
| Molecular Formula | C6H11N3S2 |
| Molecular Weight | 189.31 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 4-butyl-1,2,4-triazolidine-3,5-dithione |
| SMILES | CCCCn1c(=S)[nH][nH]c1=S |
| InChI | InChI=1S/C6H11N3S2/c1-2-3-4-9-5(10)7-8-6(9)11/h2-4H2,1H3,(H,7,10)(H,8,11) |
| InChIKey | DONGNZDECHITKF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 36.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|