C22H16N4O2S — CID 1456631
N-[3-[(4-cyanophenyl)methyl]-2-methyl-4-oxoquinazolin-6-yl]thiophene-2-carboxamide (PubChem CID 1456631) has the molecular formula C22H16N4O2S and a molecular weight of 400.46 g/mol. Its IUPAC name is N-[3-[(4-cyanophenyl)methyl]-2-methyl-4-oxoquinazolin-6-yl]thiophene-2-carboxamide.
| Compound Name | N-[3-[(4-cyanophenyl)methyl]-2-methyl-4-oxoquinazolin-6-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 1456631 |
| Molecular Formula | C22H16N4O2S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | N-[3-[(4-cyanophenyl)methyl]-2-methyl-4-oxoquinazolin-6-yl]thiophene-2-carboxamide |
| SMILES | Cc1nc2ccc(NC(=O)c3cccs3)cc2c(=O)n1Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C22H16N4O2S/c1-14-24-19-9-8-17(25-21(27)20-3-2-10-29-20)11-18(19)22(28)26(14)13-16-6-4-15(12-23)5-7-16/h2-11H,13H2,1H3,(H,25,27) |
| InChIKey | LQAVMELDAHFELR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |