About 4,9-dimethylidenecyclodeca-1,6-diyne
4,9-dimethylidenecyclodeca-1,6-diyne (PubChem CID 14566409) has the molecular formula C12H12
and a molecular weight of 156.23 g/mol. Its IUPAC name is 4,9-dimethylidenecyclodeca-1,6-diyne.
Molecular Properties
| Compound Name | 4,9-dimethylidenecyclodeca-1,6-diyne |
| PubChem CID | 14566409 |
| Molecular Formula | C12H12 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 4,9-dimethylidenecyclodeca-1,6-diyne |
| SMILES | C=C1CC#CCC(=C)CC#CC1 |
| InChI | InChI=1S/C12H12/c1-11-7-3-5-9-12(2)10-6-4-8-11/h1-2,7-10H2 |
| InChIKey | RIYARVNFGOKXID-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,9-dimethylidenecyclodeca-1,6-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,9-dimethylidenecyclodeca-1,6-diyne?
The IUPAC name of 4,9-dimethylidenecyclodeca-1,6-diyne (CID 14566409) is 4,9-dimethylidenecyclodeca-1,6-diyne.
What is the SMILES notation for 4,9-dimethylidenecyclodeca-1,6-diyne?
The canonical SMILES for 4,9-dimethylidenecyclodeca-1,6-diyne is C=C1CC#CCC(=C)CC#CC1.
What is the InChIKey of 4,9-dimethylidenecyclodeca-1,6-diyne?
The InChIKey is RIYARVNFGOKXID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12/c1-11-7-3-5-9-12(2)10-6-4-8-11/h1-2,7-10H2.
What are the key properties of 4,9-dimethylidenecyclodeca-1,6-diyne?
4,9-dimethylidenecyclodeca-1,6-diyne has a molecular weight of 156.23 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,9-dimethylidenecyclodeca-1,6-diyne is sourced from PubChem (CID 14566409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).