About [(1R,2R)-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-yl] acetate
[(1R,2R)-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-yl] acetate (PubChem CID 14566536) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is [(1R,2R)-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-yl] acetate.
Analyze [(1R,2R)-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-yl] acetate?
The IUPAC name of [(1R,2R)-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-yl] acetate (CID 14566536) is [(1R,2R)-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-yl] acetate.
What is the SMILES notation for [(1R,2R)-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-yl] acetate?
The canonical SMILES for [(1R,2R)-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-yl] acetate is CO[C@]1(C)C=CC(=O)[C@@H]1OC(C)=O.
What is the InChIKey of [(1R,2R)-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-yl] acetate?
The InChIKey is JQGAYIRDBXDVPV-DTWKUNHWSA-N. The full InChI is InChI=1S/C9H12O4/c1-6(10)13-8-7(11)4-5-9(8,2)12-3/h4-5,8H,1-3H3/t8-,9+/m0/s1.
What are the key properties of [(1R,2R)-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-yl] acetate?
[(1R,2R)-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-yl] acetate has a molecular weight of 184.19 g/mol, XLogP of 0.46, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-yl] acetate is sourced from PubChem (CID 14566536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).