C7H8O4 — CID 14566549
(1R,2R,4R,6R)-4-(methoxymethyl)-3,7-dioxatricyclo[4.1.0.02,4]heptan-5-one (PubChem CID 14566549) has the molecular formula C7H8O4 and a molecular weight of 156.14 g/mol. Its IUPAC name is (1R,2R,4R,6R)-4-(methoxymethyl)-3,7-dioxatricyclo[4.1.0.02,4]heptan-5-one.
| Compound Name | (1R,2R,4R,6R)-4-(methoxymethyl)-3,7-dioxatricyclo[4.1.0.02,4]heptan-5-one |
|---|---|
| PubChem CID | 14566549 |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | (1R,2R,4R,6R)-4-(methoxymethyl)-3,7-dioxatricyclo[4.1.0.02,4]heptan-5-one |
| SMILES | COC[C@@]12O[C@@H]1[C@H]1O[C@H]1C2=O |
| InChI | InChI=1S/C7H8O4/c1-9-2-7-5(8)3-4(10-3)6(7)11-7/h3-4,6H,2H2,1H3/t3-,4+,6-,7+/m1/s1 |
| InChIKey | VZIJUWNVZPLWCY-LCZOEFHHSA-N |
| XLogP | -0.88 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|