C8H10O4 — CID 14566551
(1R,2R,4R,6R)-4-(ethoxymethyl)-3,7-dioxatricyclo[4.1.0.02,4]heptan-5-one (PubChem CID 14566551) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is (1R,2R,4R,6R)-4-(ethoxymethyl)-3,7-dioxatricyclo[4.1.0.02,4]heptan-5-one.
| Compound Name | (1R,2R,4R,6R)-4-(ethoxymethyl)-3,7-dioxatricyclo[4.1.0.02,4]heptan-5-one |
|---|---|
| PubChem CID | 14566551 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | (1R,2R,4R,6R)-4-(ethoxymethyl)-3,7-dioxatricyclo[4.1.0.02,4]heptan-5-one |
| SMILES | CCOC[C@@]12O[C@@H]1[C@H]1O[C@H]1C2=O |
| InChI | InChI=1S/C8H10O4/c1-2-10-3-8-6(9)4-5(11-4)7(8)12-8/h4-5,7H,2-3H2,1H3/t4-,5+,7-,8+/m1/s1 |
| InChIKey | ZZYQKUZERMKHFL-ROHCDXGRSA-N |
| XLogP | -0.49 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|