About 1,6-dimethyl-2,4-dioxopyrimidine-5-carbonitrile
1,6-dimethyl-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 14566662) has the molecular formula C7H7N3O2
and a molecular weight of 165.15 g/mol. Its IUPAC name is 1,6-dimethyl-2,4-dioxopyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 1,6-dimethyl-2,4-dioxopyrimidine-5-carbonitrile |
| PubChem CID | 14566662 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | 1,6-dimethyl-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | Cc1c(C#N)c(=O)[nH]c(=O)n1C |
| InChI | InChI=1S/C7H7N3O2/c1-4-5(3-8)6(11)9-7(12)10(4)2/h1-2H3,(H,9,11,12) |
| InChIKey | KKMBCMVGVAEMEF-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,6-dimethyl-2,4-dioxopyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethyl-2,4-dioxopyrimidine-5-carbonitrile?
The IUPAC name of 1,6-dimethyl-2,4-dioxopyrimidine-5-carbonitrile (CID 14566662) is 1,6-dimethyl-2,4-dioxopyrimidine-5-carbonitrile.
What is the SMILES notation for 1,6-dimethyl-2,4-dioxopyrimidine-5-carbonitrile?
The canonical SMILES for 1,6-dimethyl-2,4-dioxopyrimidine-5-carbonitrile is Cc1c(C#N)c(=O)[nH]c(=O)n1C.
What is the InChIKey of 1,6-dimethyl-2,4-dioxopyrimidine-5-carbonitrile?
The InChIKey is KKMBCMVGVAEMEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2/c1-4-5(3-8)6(11)9-7(12)10(4)2/h1-2H3,(H,9,11,12).
What are the key properties of 1,6-dimethyl-2,4-dioxopyrimidine-5-carbonitrile?
1,6-dimethyl-2,4-dioxopyrimidine-5-carbonitrile has a molecular weight of 165.15 g/mol, XLogP of -0.75, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethyl-2,4-dioxopyrimidine-5-carbonitrile is sourced from PubChem (CID 14566662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).