About (6-imino-1,3-dimethyl-2H-pyrazin-5-ylidene)methanamine
(6-imino-1,3-dimethyl-2H-pyrazin-5-ylidene)methanamine (PubChem CID 145668127) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is (6-imino-1,3-dimethyl-2H-pyrazin-5-ylidene)methanamine.
Molecular Properties
| Compound Name | (6-imino-1,3-dimethyl-2H-pyrazin-5-ylidene)methanamine |
| PubChem CID | 145668127 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | (6-imino-1,3-dimethyl-2H-pyrazin-5-ylidene)methanamine |
| SMILES | CC1=NC(=CN)C(=N)N(C1)C |
| InChI | InChI=1S/C7H12N4/c1-5-4-11(2)7(9)6(3-8)10-5/h3,9H,4,8H2,1-2H3 |
| InChIKey | YGPPUSUSQROCRX-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | 239 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (6-imino-1,3-dimethyl-2H-pyrazin-5-ylidene)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-imino-1,3-dimethyl-2H-pyrazin-5-ylidene)methanamine?
The IUPAC name of (6-imino-1,3-dimethyl-2H-pyrazin-5-ylidene)methanamine (CID 145668127) is (6-imino-1,3-dimethyl-2H-pyrazin-5-ylidene)methanamine.
What is the SMILES notation for (6-imino-1,3-dimethyl-2H-pyrazin-5-ylidene)methanamine?
The canonical SMILES for (6-imino-1,3-dimethyl-2H-pyrazin-5-ylidene)methanamine is CC1=NC(=CN)C(=N)N(C1)C.
What is the InChIKey of (6-imino-1,3-dimethyl-2H-pyrazin-5-ylidene)methanamine?
The InChIKey is YGPPUSUSQROCRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4/c1-5-4-11(2)7(9)6(3-8)10-5/h3,9H,4,8H2,1-2H3.
What are the key properties of (6-imino-1,3-dimethyl-2H-pyrazin-5-ylidene)methanamine?
(6-imino-1,3-dimethyl-2H-pyrazin-5-ylidene)methanamine has a molecular weight of 152.20 g/mol, XLogP of -0.90, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-imino-1,3-dimethyl-2H-pyrazin-5-ylidene)methanamine is sourced from PubChem (CID 145668127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).