About 4-(4-nitrophenyl)-1,3-oxazole
4-(4-nitrophenyl)-1,3-oxazole (PubChem CID 14567797) has the molecular formula C9H6N2O3
and a molecular weight of 190.16 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-1,3-oxazole.
Molecular Properties
| Compound Name | 4-(4-nitrophenyl)-1,3-oxazole |
| PubChem CID | 14567797 |
| Molecular Formula | C9H6N2O3 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | 4-(4-nitrophenyl)-1,3-oxazole |
| SMILES | O=[N+]([O-])c1ccc(-c2cocn2)cc1 |
| InChI | InChI=1S/C9H6N2O3/c12-11(13)8-3-1-7(2-4-8)9-5-14-6-10-9/h1-6H |
| InChIKey | STSISQMFQWBGLZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-nitrophenyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-nitrophenyl)-1,3-oxazole?
The IUPAC name of 4-(4-nitrophenyl)-1,3-oxazole (CID 14567797) is 4-(4-nitrophenyl)-1,3-oxazole.
What is the SMILES notation for 4-(4-nitrophenyl)-1,3-oxazole?
The canonical SMILES for 4-(4-nitrophenyl)-1,3-oxazole is O=[N+]([O-])c1ccc(-c2cocn2)cc1.
What is the InChIKey of 4-(4-nitrophenyl)-1,3-oxazole?
The InChIKey is STSISQMFQWBGLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O3/c12-11(13)8-3-1-7(2-4-8)9-5-14-6-10-9/h1-6H.
What are the key properties of 4-(4-nitrophenyl)-1,3-oxazole?
4-(4-nitrophenyl)-1,3-oxazole has a molecular weight of 190.16 g/mol, XLogP of 2.25, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-nitrophenyl)-1,3-oxazole is sourced from PubChem (CID 14567797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).