About (2-fluorocyclohexyl) trifluoromethanesulfonate
(2-fluorocyclohexyl) trifluoromethanesulfonate (PubChem CID 14568555) has the molecular formula C7H10F4O3S
and a molecular weight of 250.21 g/mol. Its IUPAC name is (2-fluorocyclohexyl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (2-fluorocyclohexyl) trifluoromethanesulfonate |
| PubChem CID | 14568555 |
| Molecular Formula | C7H10F4O3S |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | (2-fluorocyclohexyl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1CCCCC1F)C(F)(F)F |
| InChI | InChI=1S/C7H10F4O3S/c8-5-3-1-2-4-6(5)14-15(12,13)7(9,10)11/h5-6H,1-4H2 |
| InChIKey | FDDBKVQMYVAPDI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (2-fluorocyclohexyl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorocyclohexyl) trifluoromethanesulfonate?
The IUPAC name of (2-fluorocyclohexyl) trifluoromethanesulfonate (CID 14568555) is (2-fluorocyclohexyl) trifluoromethanesulfonate.
What is the SMILES notation for (2-fluorocyclohexyl) trifluoromethanesulfonate?
The canonical SMILES for (2-fluorocyclohexyl) trifluoromethanesulfonate is O=S(=O)(OC1CCCCC1F)C(F)(F)F.
What is the InChIKey of (2-fluorocyclohexyl) trifluoromethanesulfonate?
The InChIKey is FDDBKVQMYVAPDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F4O3S/c8-5-3-1-2-4-6(5)14-15(12,13)7(9,10)11/h5-6H,1-4H2.
What are the key properties of (2-fluorocyclohexyl) trifluoromethanesulfonate?
(2-fluorocyclohexyl) trifluoromethanesulfonate has a molecular weight of 250.21 g/mol, XLogP of 2.13, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorocyclohexyl) trifluoromethanesulfonate is sourced from PubChem (CID 14568555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).