About 2,6-dimethyl-6-(2-trimethylsilylethoxymethyl)cyclohexa-2,4-dien-1-one
2,6-dimethyl-6-(2-trimethylsilylethoxymethyl)cyclohexa-2,4-dien-1-one (PubChem CID 14568583) has the molecular formula C14H24O2Si
and a molecular weight of 252.43 g/mol. Its IUPAC name is 2,6-dimethyl-6-(2-trimethylsilylethoxymethyl)cyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 2,6-dimethyl-6-(2-trimethylsilylethoxymethyl)cyclohexa-2,4-dien-1-one |
| PubChem CID | 14568583 |
| Molecular Formula | C14H24O2Si |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 2,6-dimethyl-6-(2-trimethylsilylethoxymethyl)cyclohexa-2,4-dien-1-one |
| SMILES | CC1=CC=CC(C)(COCC[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C14H24O2Si/c1-12-7-6-8-14(2,13(12)15)11-16-9-10-17(3,4)5/h6-8H,9-11H2,1-5H3 |
| InChIKey | LPQYMZZKTBQBHM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-6-(2-trimethylsilylethoxymethyl)cyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-6-(2-trimethylsilylethoxymethyl)cyclohexa-2,4-dien-1-one?
The IUPAC name of 2,6-dimethyl-6-(2-trimethylsilylethoxymethyl)cyclohexa-2,4-dien-1-one (CID 14568583) is 2,6-dimethyl-6-(2-trimethylsilylethoxymethyl)cyclohexa-2,4-dien-1-one.
What is the SMILES notation for 2,6-dimethyl-6-(2-trimethylsilylethoxymethyl)cyclohexa-2,4-dien-1-one?
The canonical SMILES for 2,6-dimethyl-6-(2-trimethylsilylethoxymethyl)cyclohexa-2,4-dien-1-one is CC1=CC=CC(C)(COCC[Si](C)(C)C)C1=O.
What is the InChIKey of 2,6-dimethyl-6-(2-trimethylsilylethoxymethyl)cyclohexa-2,4-dien-1-one?
The InChIKey is LPQYMZZKTBQBHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O2Si/c1-12-7-6-8-14(2,13(12)15)11-16-9-10-17(3,4)5/h6-8H,9-11H2,1-5H3.
What are the key properties of 2,6-dimethyl-6-(2-trimethylsilylethoxymethyl)cyclohexa-2,4-dien-1-one?
2,6-dimethyl-6-(2-trimethylsilylethoxymethyl)cyclohexa-2,4-dien-1-one has a molecular weight of 252.43 g/mol, XLogP of 3.43, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-6-(2-trimethylsilylethoxymethyl)cyclohexa-2,4-dien-1-one is sourced from PubChem (CID 14568583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).