C13H20O3 — CID 14568588
6-(2-methoxyethoxymethyl)-2,4,6-trimethylcyclohexa-2,4-dien-1-one (PubChem CID 14568588) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 6-(2-methoxyethoxymethyl)-2,4,6-trimethylcyclohexa-2,4-dien-1-one.
| Compound Name | 6-(2-methoxyethoxymethyl)-2,4,6-trimethylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 14568588 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 6-(2-methoxyethoxymethyl)-2,4,6-trimethylcyclohexa-2,4-dien-1-one |
| SMILES | COCCOCC1(C)C=C(C)C=C(C)C1=O |
| InChI | InChI=1S/C13H20O3/c1-10-7-11(2)12(14)13(3,8-10)9-16-6-5-15-4/h7-8H,5-6,9H2,1-4H3 |
| InChIKey | MPKKLASFQLYUJF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|