C15H26O2Si — CID 14568589
2,4,6-trimethyl-6-(2-trimethylsilylethoxymethyl)cyclohexa-2,4-dien-1-one (PubChem CID 14568589) has the molecular formula C15H26O2Si and a molecular weight of 266.46 g/mol. Its IUPAC name is 2,4,6-trimethyl-6-(2-trimethylsilylethoxymethyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 2,4,6-trimethyl-6-(2-trimethylsilylethoxymethyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 14568589 |
| Molecular Formula | C15H26O2Si |
| Molecular Weight | 266.46 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2,4,6-trimethyl-6-(2-trimethylsilylethoxymethyl)cyclohexa-2,4-dien-1-one |
| SMILES | CC1=CC(C)(COCC[Si](C)(C)C)C(=O)C(C)=C1 |
| InChI | InChI=1S/C15H26O2Si/c1-12-9-13(2)14(16)15(3,10-12)11-17-7-8-18(4,5)6/h9-10H,7-8,11H2,1-6H3 |
| InChIKey | YBFSRIQYUJIHCE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|