C29H42O4Si — CID 14569029
3-[(4S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-methylbutan-2-one (PubChem CID 14569029) has the molecular formula C29H42O4Si and a molecular weight of 482.74 g/mol. Its IUPAC name is 3-[(4S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-methylbutan-2-one.
| Compound Name | 3-[(4S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 14569029 |
| Molecular Formula | C29H42O4Si |
| Molecular Weight | 482.74 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 3-[(4S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-methylbutan-2-one |
| SMILES | CC(=O)C(C)(C)[C@@H]1C[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C29H42O4Si/c1-22(30)28(5,6)26-21-23(32-29(7,8)33-26)19-20-31-34(27(2,3)4,24-15-11-9-12-16-24)25-17-13-10-14-18-25/h9-18,23,26H,19-21H2,1-8H3/t23-,26+/m1/s1 |
| InChIKey | SZINVZLRVKZRKP-BVAGGSTKSA-N |
| XLogP | 5.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.74 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|