C17H20N4O — CID 14570148
4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-bis(prop-2-enyl)phenol (PubChem CID 14570148) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-bis(prop-2-enyl)phenol.
| Compound Name | 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-bis(prop-2-enyl)phenol |
|---|---|
| PubChem CID | 14570148 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-bis(prop-2-enyl)phenol |
| SMILES | C=CCc1cc(Cc2cnc(N)nc2N)cc(CC=C)c1O |
| InChI | InChI=1S/C17H20N4O/c1-3-5-12-7-11(8-13(6-4-2)15(12)22)9-14-10-20-17(19)21-16(14)18/h3-4,7-8,10,22H,1-2,5-6,9H2,(H4,18,19,20,21) |
| InChIKey | FWDNTBGILYDZAX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|