C21H19N3O — CID 14570317
(Z)-3-anilino-2-[(2-methoxy-4-methylquinolin-7-yl)methyl]prop-2-enenitrile (PubChem CID 14570317) has the molecular formula C21H19N3O and a molecular weight of 329.40 g/mol. Its IUPAC name is (Z)-3-anilino-2-[(2-methoxy-4-methylquinolin-7-yl)methyl]prop-2-enenitrile.
| Compound Name | (Z)-3-anilino-2-[(2-methoxy-4-methylquinolin-7-yl)methyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 14570317 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | (Z)-3-anilino-2-[(2-methoxy-4-methylquinolin-7-yl)methyl]prop-2-enenitrile |
| SMILES | COc1cc(C)c2ccc(C/C(C#N)=C/Nc3ccccc3)cc2n1 |
| InChI | InChI=1S/C21H19N3O/c1-15-10-21(25-2)24-20-12-16(8-9-19(15)20)11-17(13-22)14-23-18-6-4-3-5-7-18/h3-10,12,14,23H,11H2,1-2H3/b17-14- |
| InChIKey | HVWKBEGGDFJCSX-VKAVYKQESA-N |
| XLogP | 4.61 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|