C11H18O2S2 — CID 14570392
(3'aR,6'S,6'aR)-3',6'-dimethylspiro[1,3-dithiolane-2,5'-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan]-3'-ol (PubChem CID 14570392) has the molecular formula C11H18O2S2 and a molecular weight of 246.40 g/mol. Its IUPAC name is (3'aR,6'S,6'aR)-3',6'-dimethylspiro[1,3-dithiolane-2,5'-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan]-3'-ol.
| Compound Name | (3'aR,6'S,6'aR)-3',6'-dimethylspiro[1,3-dithiolane-2,5'-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan]-3'-ol |
|---|---|
| PubChem CID | 14570392 |
| Molecular Formula | C11H18O2S2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | (3'aR,6'S,6'aR)-3',6'-dimethylspiro[1,3-dithiolane-2,5'-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan]-3'-ol |
| SMILES | C[C@H]1[C@@H]2COC(C)(O)[C@@H]2CC12SCCS2 |
| InChI | InChI=1S/C11H18O2S2/c1-7-8-6-13-10(2,12)9(8)5-11(7)14-3-4-15-11/h7-9,12H,3-6H2,1-2H3/t7-,8-,9+,10?/m0/s1 |
| InChIKey | MLHDECJMJCAPOR-IZJGZUANSA-N |
| XLogP | 2.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |