C10H15NO — CID 14570429
1,2,3,4,5,5a,6,7-octahydro-1-benzazepin-8-one (PubChem CID 14570429) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 1,2,3,4,5,5a,6,7-octahydro-1-benzazepin-8-one.
| Compound Name | 1,2,3,4,5,5a,6,7-octahydro-1-benzazepin-8-one |
|---|---|
| PubChem CID | 14570429 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 1,2,3,4,5,5a,6,7-octahydro-1-benzazepin-8-one |
| SMILES | O=C1C=C2NCCCCC2CC1 |
| InChI | InChI=1S/C10H15NO/c12-9-5-4-8-3-1-2-6-11-10(8)7-9/h7-8,11H,1-6H2 |
| InChIKey | LENPJDDPEZMZGX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |