C12H20O5 — CID 14570519
ethyl (3R)-3-[(2R,4S,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]pent-4-enoate (PubChem CID 14570519) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is ethyl (3R)-3-[(2R,4S,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]pent-4-enoate.
| Compound Name | ethyl (3R)-3-[(2R,4S,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]pent-4-enoate |
|---|---|
| PubChem CID | 14570519 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | ethyl (3R)-3-[(2R,4S,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]pent-4-enoate |
| SMILES | C=C[C@@H](CC(=O)OCC)[C@@H]1O[C@H](C)OC[C@H]1O |
| InChI | InChI=1S/C12H20O5/c1-4-9(6-11(14)15-5-2)12-10(13)7-16-8(3)17-12/h4,8-10,12-13H,1,5-7H2,2-3H3/t8-,9+,10-,12+/m1/s1 |
| InChIKey | SNUDWXCBSGTZCP-KLBPJQLPSA-N |
| XLogP | 0.86 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|