C9F8N2O4 — CID 14570704
1,1,2,3,4,5,6,7-octafluoro-2,3-dinitroindene (PubChem CID 14570704) has the molecular formula C9F8N2O4 and a molecular weight of 352.09 g/mol. Its IUPAC name is 1,1,2,3,4,5,6,7-octafluoro-2,3-dinitroindene.
| Compound Name | 1,1,2,3,4,5,6,7-octafluoro-2,3-dinitroindene |
|---|---|
| PubChem CID | 14570704 |
| Molecular Formula | C9F8N2O4 |
| Molecular Weight | 352.09 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 1,1,2,3,4,5,6,7-octafluoro-2,3-dinitroindene |
| SMILES | O=[N+]([O-])C1(F)c2c(F)c(F)c(F)c(F)c2C(F)(F)C1(F)[N+](=O)[O-] |
| InChI | InChI=1S/C9F8N2O4/c10-3-1-2(4(11)6(13)5(3)12)8(16,18(20)21)9(17,19(22)23)7(1,14)15 |
| InChIKey | HJMWTUHTRMWTBS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.09 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|