C30H46N2Si2 — CID 14571673
1,1,3,3-tetratert-butyl-2-N,4-N-diphenyl-1,3-disiletane-2,4-diimine (PubChem CID 14571673) has the molecular formula C30H46N2Si2 and a molecular weight of 490.88 g/mol. Its IUPAC name is 1,1,3,3-tetratert-butyl-2-N,4-N-diphenyl-1,3-disiletane-2,4-diimine.
| Compound Name | 1,1,3,3-tetratert-butyl-2-N,4-N-diphenyl-1,3-disiletane-2,4-diimine |
|---|---|
| PubChem CID | 14571673 |
| Molecular Formula | C30H46N2Si2 |
| Molecular Weight | 490.88 g/mol |
| Exact Mass | 490.32 |
| IUPAC Name | 1,1,3,3-tetratert-butyl-2-N,4-N-diphenyl-1,3-disiletane-2,4-diimine |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)C(=Nc2ccccc2)[Si](C(C)(C)C)(C(C)(C)C)C1=Nc1ccccc1 |
| InChI | InChI=1S/C30H46N2Si2/c1-27(2,3)33(28(4,5)6)25(31-23-19-15-13-16-20-23)34(29(7,8)9,30(10,11)12)26(33)32-24-21-17-14-18-22-24/h13-22H,1-12H3/b31-25-,32-26+ |
| InChIKey | QNGJEYQYNPPXCB-IEPGDLOPSA-N |
| XLogP | 9.80 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.88 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|