C34H45NO5S — CID 14573719
3-[3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylcarbamoyl]-4-hydroxynaphthalen-1-yl]sulfanylpropanoic acid (PubChem CID 14573719) has the molecular formula C34H45NO5S and a molecular weight of 579.80 g/mol. Its IUPAC name is 3-[3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylcarbamoyl]-4-hydroxynaphthalen-1-yl]sulfanylpropanoic acid.
| Compound Name | 3-[3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylcarbamoyl]-4-hydroxynaphthalen-1-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 14573719 |
| Molecular Formula | C34H45NO5S |
| Molecular Weight | 579.80 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | 3-[3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylcarbamoyl]-4-hydroxynaphthalen-1-yl]sulfanylpropanoic acid |
| SMILES | CCC(C)(C)c1ccc(OCCCCNC(=O)c2cc(SCCC(=O)O)c3ccccc3c2O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C34H45NO5S/c1-7-33(3,4)23-15-16-28(27(21-23)34(5,6)8-2)40-19-12-11-18-35-32(39)26-22-29(41-20-17-30(36)37)24-13-9-10-14-25(24)31(26)38/h9-10,13-16,21-22,38H,7-8,11-12,17-20H2,1-6H3,(H,35,39)(H,36,37) |
| InChIKey | HBJKLBVNFMJRCH-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.80 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|