About (5-oxooxolan-3-yl) octanoate
(5-oxooxolan-3-yl) octanoate (PubChem CID 14574411) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is (5-oxooxolan-3-yl) octanoate.
Molecular Properties
| Compound Name | (5-oxooxolan-3-yl) octanoate |
| PubChem CID | 14574411 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (5-oxooxolan-3-yl) octanoate |
| SMILES | CCCCCCCC(=O)OC1COC(=O)C1 |
| InChI | InChI=1S/C12H20O4/c1-2-3-4-5-6-7-11(13)16-10-8-12(14)15-9-10/h10H,2-9H2,1H3 |
| InChIKey | VVEZAXXCQQTZNW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (5-oxooxolan-3-yl) octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-oxooxolan-3-yl) octanoate?
The IUPAC name of (5-oxooxolan-3-yl) octanoate (CID 14574411) is (5-oxooxolan-3-yl) octanoate.
What is the SMILES notation for (5-oxooxolan-3-yl) octanoate?
The canonical SMILES for (5-oxooxolan-3-yl) octanoate is CCCCCCCC(=O)OC1COC(=O)C1.
What is the InChIKey of (5-oxooxolan-3-yl) octanoate?
The InChIKey is VVEZAXXCQQTZNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-2-3-4-5-6-7-11(13)16-10-8-12(14)15-9-10/h10H,2-9H2,1H3.
What are the key properties of (5-oxooxolan-3-yl) octanoate?
(5-oxooxolan-3-yl) octanoate has a molecular weight of 228.29 g/mol, XLogP of 2.21, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-oxooxolan-3-yl) octanoate is sourced from PubChem (CID 14574411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).