C8H8F6O4S — CID 14574862
2-[2-(2,2,2-trifluoroacetyl)oxyethylsulfanyl]ethyl 2,2,2-trifluoroacetate (PubChem CID 14574862) has the molecular formula C8H8F6O4S and a molecular weight of 314.20 g/mol. Its IUPAC name is 2-[2-(2,2,2-trifluoroacetyl)oxyethylsulfanyl]ethyl 2,2,2-trifluoroacetate.
| Compound Name | 2-[2-(2,2,2-trifluoroacetyl)oxyethylsulfanyl]ethyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 14574862 |
| Molecular Formula | C8H8F6O4S |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 2-[2-(2,2,2-trifluoroacetyl)oxyethylsulfanyl]ethyl 2,2,2-trifluoroacetate |
| SMILES | O=C(OCCSCCOC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H8F6O4S/c9-7(10,11)5(15)17-1-3-19-4-2-18-6(16)8(12,13)14/h1-4H2 |
| InChIKey | VMIZTZLHIUYQRN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|