C12H8F14O4S — CID 14574865
2-[2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)ethylsulfanyl]ethyl 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 14574865) has the molecular formula C12H8F14O4S and a molecular weight of 514.23 g/mol. Its IUPAC name is 2-[2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)ethylsulfanyl]ethyl 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | 2-[2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)ethylsulfanyl]ethyl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 14574865 |
| Molecular Formula | C12H8F14O4S |
| Molecular Weight | 514.23 g/mol |
| Exact Mass | 513.99 |
| IUPAC Name | 2-[2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)ethylsulfanyl]ethyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | O=C(OCCSCCOC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H8F14O4S/c13-7(14,9(17,18)11(21,22)23)5(27)29-1-3-31-4-2-30-6(28)8(15,16)10(19,20)12(24,25)26/h1-4H2 |
| InChIKey | DJTKRSHHSSMFGH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.23 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|