About [2-(2,6-dimethylhept-5-enyl)-1,3-dioxolan-4-yl]methanol
[2-(2,6-dimethylhept-5-enyl)-1,3-dioxolan-4-yl]methanol (PubChem CID 14575177) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is [2-(2,6-dimethylhept-5-enyl)-1,3-dioxolan-4-yl]methanol.
Molecular Properties
| Compound Name | [2-(2,6-dimethylhept-5-enyl)-1,3-dioxolan-4-yl]methanol |
| PubChem CID | 14575177 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | [2-(2,6-dimethylhept-5-enyl)-1,3-dioxolan-4-yl]methanol |
| SMILES | CC(C)=CCCC(C)CC1OCC(CO)O1 |
| InChI | InChI=1S/C13H24O3/c1-10(2)5-4-6-11(3)7-13-15-9-12(8-14)16-13/h5,11-14H,4,6-9H2,1-3H3 |
| InChIKey | BRSGMGCILUYMHR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,6-dimethylhept-5-enyl)-1,3-dioxolan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,6-dimethylhept-5-enyl)-1,3-dioxolan-4-yl]methanol?
The IUPAC name of [2-(2,6-dimethylhept-5-enyl)-1,3-dioxolan-4-yl]methanol (CID 14575177) is [2-(2,6-dimethylhept-5-enyl)-1,3-dioxolan-4-yl]methanol.
What is the SMILES notation for [2-(2,6-dimethylhept-5-enyl)-1,3-dioxolan-4-yl]methanol?
The canonical SMILES for [2-(2,6-dimethylhept-5-enyl)-1,3-dioxolan-4-yl]methanol is CC(C)=CCCC(C)CC1OCC(CO)O1.
What is the InChIKey of [2-(2,6-dimethylhept-5-enyl)-1,3-dioxolan-4-yl]methanol?
The InChIKey is BRSGMGCILUYMHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O3/c1-10(2)5-4-6-11(3)7-13-15-9-12(8-14)16-13/h5,11-14H,4,6-9H2,1-3H3.
What are the key properties of [2-(2,6-dimethylhept-5-enyl)-1,3-dioxolan-4-yl]methanol?
[2-(2,6-dimethylhept-5-enyl)-1,3-dioxolan-4-yl]methanol has a molecular weight of 228.33 g/mol, XLogP of 2.49, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,6-dimethylhept-5-enyl)-1,3-dioxolan-4-yl]methanol is sourced from PubChem (CID 14575177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).