C40H42N3OPt- — CID 145751808
2,4-Ditert-butyl-6-[4-(2-methylpropyl)-6-(3-pyrido[2,3-b]indol-9-ylbenzene-2-id-1-yl)-2-pyridinyl]phenol;platinum (PubChem CID 145751808) has the molecular formula C40H42N3OPt- and a molecular weight of 775.90 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[4-(2-methylpropyl)-6-(3-pyrido[2,3-b]indol-9-ylbenzene-2-id-1-yl)-2-pyridinyl]phenol;platinum.
| Compound Name | 2,4-Ditert-butyl-6-[4-(2-methylpropyl)-6-(3-pyrido[2,3-b]indol-9-ylbenzene-2-id-1-yl)-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 145751808 |
| Molecular Formula | C40H42N3OPt- |
| Molecular Weight | 775.90 g/mol |
| Exact Mass | 775.30 |
| IUPAC Name | 2,4-ditert-butyl-6-[4-(2-methylpropyl)-6-(3-pyrido[2,3-b]indol-9-ylbenzene-2-id-1-yl)-2-pyridinyl]phenol;platinum |
| SMILES | CC(C)CC1=CC(=NC(=C1)C2=C(C(=CC(=C2)C(C)(C)C)C(C)(C)C)O)C3=[C-]C(=CC=C3)N4C5=CC=CC=C5C6=C4N=CC=C6.[Pt] |
| InChI | InChI=1S/C40H42N3O.Pt/c1-25(2)19-26-20-34(42-35(21-26)32-23-28(39(3,4)5)24-33(37(32)44)40(6,7)8)27-13-11-14-29(22-27)43-36-17-10-9-15-30(36)31-16-12-18-41-38(31)43;/h9-18,20-21,23-25,44H,19H2,1-8H3;/q-1; |
| InChIKey | WRWDNBHOBCFXSK-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 50.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | 1100 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|