C14H14F5NO — CID 14575207
(1S,5R)-8-methyl-3-(2,3,4,5,6-pentafluorophenoxy)-8-azabicyclo[3.2.1]octane (PubChem CID 14575207) has the molecular formula C14H14F5NO and a molecular weight of 307.26 g/mol. Its IUPAC name is (1S,5R)-8-methyl-3-(2,3,4,5,6-pentafluorophenoxy)-8-azabicyclo[3.2.1]octane.
| Compound Name | (1S,5R)-8-methyl-3-(2,3,4,5,6-pentafluorophenoxy)-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 14575207 |
| Molecular Formula | C14H14F5NO |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (1S,5R)-8-methyl-3-(2,3,4,5,6-pentafluorophenoxy)-8-azabicyclo[3.2.1]octane |
| SMILES | CN1[C@@H]2CC[C@H]1CC(Oc1c(F)c(F)c(F)c(F)c1F)C2 |
| InChI | InChI=1S/C14H14F5NO/c1-20-6-2-3-7(20)5-8(4-6)21-14-12(18)10(16)9(15)11(17)13(14)19/h6-8H,2-5H2,1H3/t6-,7+,8? |
| InChIKey | SUULUTCCYWIQEX-DHBOJHSNSA-N |
| XLogP | 3.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|