About 1-cyclopropyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-fluorophenyl)urea
1-cyclopropyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-fluorophenyl)urea (PubChem CID 1457580) has the molecular formula C22H22FN3O2
and a molecular weight of 379.44 g/mol. Its IUPAC name is 1-cyclopropyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-fluorophenyl)urea.
Molecular Properties
| Compound Name | 1-cyclopropyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-fluorophenyl)urea |
| PubChem CID | 1457580 |
| Molecular Formula | C22H22FN3O2 |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 1-cyclopropyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-fluorophenyl)urea |
| SMILES | Cc1cc(C)c2[nH]c(=O)c(CN(C(=O)Nc3ccccc3F)C3CC3)cc2c1 |
| InChI | InChI=1S/C22H22FN3O2/c1-13-9-14(2)20-15(10-13)11-16(21(27)25-20)12-26(17-7-8-17)22(28)24-19-6-4-3-5-18(19)23/h3-6,9-11,17H,7-8,12H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | QXWWGWAJSPJSNN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopropyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-fluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-fluorophenyl)urea?
The IUPAC name of 1-cyclopropyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-fluorophenyl)urea (CID 1457580) is 1-cyclopropyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-fluorophenyl)urea.
What is the SMILES notation for 1-cyclopropyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-fluorophenyl)urea?
The canonical SMILES for 1-cyclopropyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-fluorophenyl)urea is Cc1cc(C)c2[nH]c(=O)c(CN(C(=O)Nc3ccccc3F)C3CC3)cc2c1.
What is the InChIKey of 1-cyclopropyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-fluorophenyl)urea?
The InChIKey is QXWWGWAJSPJSNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22FN3O2/c1-13-9-14(2)20-15(10-13)11-16(21(27)25-20)12-26(17-7-8-17)22(28)24-19-6-4-3-5-18(19)23/h3-6,9-11,17H,7-8,12H2,1-2H3,(H,24,28)(H,25,27).
What are the key properties of 1-cyclopropyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-fluorophenyl)urea?
1-cyclopropyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-fluorophenyl)urea has a molecular weight of 379.44 g/mol, XLogP of 4.48, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-fluorophenyl)urea is sourced from PubChem (CID 1457580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).