About (Z)-5-(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)pent-4-enoic acid
(Z)-5-(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)pent-4-enoic acid (PubChem CID 14576198) has the molecular formula C17H18N2O2
and a molecular weight of 282.34 g/mol. Its IUPAC name is (Z)-5-(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)pent-4-enoic acid.
Molecular Properties
| Compound Name | (Z)-5-(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)pent-4-enoic acid |
| PubChem CID | 14576198 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (Z)-5-(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)pent-4-enoic acid |
| SMILES | O=C(O)CC/C=C\c1nn(-c2ccccc2)c2c1CCC2 |
| InChI | InChI=1S/C17H18N2O2/c20-17(21)12-5-4-10-15-14-9-6-11-16(14)19(18-15)13-7-2-1-3-8-13/h1-4,7-8,10H,5-6,9,11-12H2,(H,20,21)/b10-4- |
| InChIKey | LODUVZGQRRMDJF-WMZJFQQLSA-N |
| XLogP | 3.24 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-5-(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)pent-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5-(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)pent-4-enoic acid?
The IUPAC name of (Z)-5-(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)pent-4-enoic acid (CID 14576198) is (Z)-5-(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)pent-4-enoic acid.
What is the SMILES notation for (Z)-5-(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)pent-4-enoic acid?
The canonical SMILES for (Z)-5-(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)pent-4-enoic acid is O=C(O)CC/C=C\c1nn(-c2ccccc2)c2c1CCC2.
What is the InChIKey of (Z)-5-(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)pent-4-enoic acid?
The InChIKey is LODUVZGQRRMDJF-WMZJFQQLSA-N. The full InChI is InChI=1S/C17H18N2O2/c20-17(21)12-5-4-10-15-14-9-6-11-16(14)19(18-15)13-7-2-1-3-8-13/h1-4,7-8,10H,5-6,9,11-12H2,(H,20,21)/b10-4-.
What are the key properties of (Z)-5-(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)pent-4-enoic acid?
(Z)-5-(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)pent-4-enoic acid has a molecular weight of 282.34 g/mol, XLogP of 3.24, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5-(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)pent-4-enoic acid is sourced from PubChem (CID 14576198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).