C26H32FN3O3 — CID 14576394
4-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-4-azatricyclo[5.2.2.02,6]undecane-3,5-dione (PubChem CID 14576394) has the molecular formula C26H32FN3O3 and a molecular weight of 453.56 g/mol. Its IUPAC name is 4-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-4-azatricyclo[5.2.2.02,6]undecane-3,5-dione.
| Compound Name | 4-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-4-azatricyclo[5.2.2.02,6]undecane-3,5-dione |
|---|---|
| PubChem CID | 14576394 |
| Molecular Formula | C26H32FN3O3 |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 4-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-4-azatricyclo[5.2.2.02,6]undecane-3,5-dione |
| SMILES | O=C1C2C3CCC(CC3)C2C(=O)N1CCCCN1CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C26H32FN3O3/c27-19-7-8-20-21(15-19)33-28-24(20)18-9-13-29(14-10-18)11-1-2-12-30-25(31)22-16-3-4-17(6-5-16)23(22)26(30)32/h7-8,15-18,22-23H,1-6,9-14H2 |
| InChIKey | NYHLWGBWWYCIKA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|