About (3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl) acetate
(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl) acetate (PubChem CID 14576424) has the molecular formula C11H12O5
and a molecular weight of 224.21 g/mol. Its IUPAC name is (3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl) acetate.
Molecular Properties
| Compound Name | (3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl) acetate |
| PubChem CID | 14576424 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | (3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl) acetate |
| SMILES | CC(=O)OC1CC2CC1C1C(=O)OC(=O)C21 |
| InChI | InChI=1S/C11H12O5/c1-4(12)15-7-3-5-2-6(7)9-8(5)10(13)16-11(9)14/h5-9H,2-3H2,1H3 |
| InChIKey | ZUAVPJFSWBLLAP-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl) acetate?
The IUPAC name of (3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl) acetate (CID 14576424) is (3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl) acetate.
What is the SMILES notation for (3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl) acetate?
The canonical SMILES for (3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl) acetate is CC(=O)OC1CC2CC1C1C(=O)OC(=O)C21.
What is the InChIKey of (3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl) acetate?
The InChIKey is ZUAVPJFSWBLLAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O5/c1-4(12)15-7-3-5-2-6(7)9-8(5)10(13)16-11(9)14/h5-9H,2-3H2,1H3.
What are the key properties of (3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl) acetate?
(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl) acetate has a molecular weight of 224.21 g/mol, XLogP of 0.27, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl) acetate is sourced from PubChem (CID 14576424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).