C20H34O2S — CID 14576502
methyl 4-[(1E,3Z,6Z)-pentadeca-1,3,6-trienyl]sulfanylbutanoate (PubChem CID 14576502) has the molecular formula C20H34O2S and a molecular weight of 338.56 g/mol. Its IUPAC name is methyl 4-[(1E,3Z,6Z)-pentadeca-1,3,6-trienyl]sulfanylbutanoate.
| Compound Name | methyl 4-[(1E,3Z,6Z)-pentadeca-1,3,6-trienyl]sulfanylbutanoate |
|---|---|
| PubChem CID | 14576502 |
| Molecular Formula | C20H34O2S |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | methyl 4-[(1E,3Z,6Z)-pentadeca-1,3,6-trienyl]sulfanylbutanoate |
| SMILES | CCCCCCCC/C=C\C/C=C\C=C\SCCCC(=O)OC |
| InChI | InChI=1S/C20H34O2S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-23-19-16-17-20(21)22-2/h10-11,13-15,18H,3-9,12,16-17,19H2,1-2H3/b11-10-,14-13-,18-15+ |
| InChIKey | BCCIWBSBPMCVDG-CVWBSBFRSA-N |
| XLogP | 6.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|